C24H21N4O3+ — CID 142057078
methoxy-methylidene-[1-methyl-3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]azanium (PubChem CID 142057078) has the molecular formula C24H21N4O3+ and a molecular weight of 413.46 g/mol. Its IUPAC name is methoxy-methylidene-[1-methyl-3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]azanium.
| Compound Name | methoxy-methylidene-[1-methyl-3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]azanium |
|---|---|
| PubChem CID | 142057078 |
| Molecular Formula | C24H21N4O3+ |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | methoxy-methylidene-[1-methyl-3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-6-yl]azanium |
| SMILES | C=[N+](OC)c1ccc2c(C3=C(c4cn(C)c5ccccc45)C(=O)NC3=O)cn(C)c2c1 |
| InChI | InChI=1S/C24H20N4O3/c1-26-12-17(15-7-5-6-8-19(15)26)21-22(24(30)25-23(21)29)18-13-27(2)20-11-14(28(3)31-4)9-10-16(18)20/h5-13H,3H2,1-2,4H3/p+1 |
| InChIKey | OOLCRGYTMUENLP-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|