C19H24N2OS — CID 142057392
N-[4-(4-cyclopentyl-2-ethyl-1,3-thiazol-5-yl)phenyl]propanamide (PubChem CID 142057392) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[4-(4-cyclopentyl-2-ethyl-1,3-thiazol-5-yl)phenyl]propanamide.
| Compound Name | N-[4-(4-cyclopentyl-2-ethyl-1,3-thiazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 142057392 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[4-(4-cyclopentyl-2-ethyl-1,3-thiazol-5-yl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(-c2sc(CC)nc2C2CCCC2)cc1 |
| InChI | InChI=1S/C19H24N2OS/c1-3-16(22)20-15-11-9-14(10-12-15)19-18(13-7-5-6-8-13)21-17(4-2)23-19/h9-13H,3-8H2,1-2H3,(H,20,22) |
| InChIKey | HFZVNBUHLGLMJX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |