C12H21N3 — CID 142057856
3-[(1R)-2,2-dimethylcyclopropyl]-5-pentyl-1H-1,2,4-triazole (PubChem CID 142057856) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-[(1R)-2,2-dimethylcyclopropyl]-5-pentyl-1H-1,2,4-triazole.
| Compound Name | 3-[(1R)-2,2-dimethylcyclopropyl]-5-pentyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 142057856 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-[(1R)-2,2-dimethylcyclopropyl]-5-pentyl-1H-1,2,4-triazole |
| SMILES | CCCCCc1nc([C@@H]2CC2(C)C)n[nH]1 |
| InChI | InChI=1S/C12H21N3/c1-4-5-6-7-10-13-11(15-14-10)9-8-12(9,2)3/h9H,4-8H2,1-3H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | MUUJDLSHTNSSSR-VIFPVBQESA-N |
| XLogP | 3.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|