About 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene
4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene (PubChem CID 142057923) has the molecular formula C17H17F
and a molecular weight of 240.32 g/mol. Its IUPAC name is 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene.
Molecular Properties
| Compound Name | 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene |
| PubChem CID | 142057923 |
| Molecular Formula | C17H17F |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene |
| SMILES | CC1(C)C[C@H]1c1ccc(F)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H17F/c1-17(2)11-15(17)13-8-9-16(18)14(10-13)12-6-4-3-5-7-12/h3-10,15H,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | BXLLYYJKXZDARH-HNNXBMFYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene?
The IUPAC name of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene (CID 142057923) is 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene.
What is the SMILES notation for 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene?
The canonical SMILES for 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene is CC1(C)C[C@H]1c1ccc(F)c(-c2ccccc2)c1.
What is the InChIKey of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene?
The InChIKey is BXLLYYJKXZDARH-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H17F/c1-17(2)11-15(17)13-8-9-16(18)14(10-13)12-6-4-3-5-7-12/h3-10,15H,11H2,1-2H3/t15-/m0/s1.
What are the key properties of 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene?
4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene has a molecular weight of 240.32 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-2,2-dimethylcyclopropyl]-1-fluoro-2-phenylbenzene is sourced from PubChem (CID 142057923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).