About 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine
1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine (PubChem CID 142058036) has the molecular formula C17H26ClN3
and a molecular weight of 307.87 g/mol. Its IUPAC name is 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine |
| PubChem CID | 142058036 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine |
| SMILES | CC.CC1(C)C[C@H]1c1cccc(Cl)c1.Cc1cnc(N)[nH]1 |
| InChI | InChI=1S/C11H13Cl.C4H7N3.C2H6/c1-11(2)7-10(11)8-4-3-5-9(12)6-8;1-3-2-6-4(5)7-3;1-2/h3-6,10H,7H2,1-2H3;2H,1H3,(H3,5,6,7);1-2H3/t10-;;/m0../s1 |
| InChIKey | VDVNWNCNJFXAGW-XRIOVQLTSA-N |
| XLogP | 5.18 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine?
The IUPAC name of 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine (CID 142058036) is 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine.
What is the SMILES notation for 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine?
The canonical SMILES for 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine is CC.CC1(C)C[C@H]1c1cccc(Cl)c1.Cc1cnc(N)[nH]1.
What is the InChIKey of 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine?
The InChIKey is VDVNWNCNJFXAGW-XRIOVQLTSA-N. The full InChI is InChI=1S/C11H13Cl.C4H7N3.C2H6/c1-11(2)7-10(11)8-4-3-5-9(12)6-8;1-3-2-6-4(5)7-3;1-2/h3-6,10H,7H2,1-2H3;2H,1H3,(H3,5,6,7);1-2H3/t10-;;/m0../s1.
What are the key properties of 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine?
1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine has a molecular weight of 307.87 g/mol, XLogP of 5.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[(1R)-2,2-dimethylcyclopropyl]benzene;ethane;5-methyl-1H-imidazol-2-amine is sourced from PubChem (CID 142058036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).