About (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide
(2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide (PubChem CID 142058732) has the molecular formula C18H25IN2
and a molecular weight of 396.32 g/mol. Its IUPAC name is (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide.
Molecular Properties
| Compound Name | (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide |
| PubChem CID | 142058732 |
| Molecular Formula | C18H25IN2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide |
| SMILES | CC/C=C1/CCCC/C1=N\C1=NC2=CCCC=C2C1C.I |
| InChI | InChI=1S/C18H24N2.HI/c1-3-8-14-9-4-6-11-16(14)19-18-13(2)15-10-5-7-12-17(15)20-18;/h8,10,12-13H,3-7,9,11H2,1-2H3;1H/b14-8-,19-16+; |
| InChIKey | NRWIYMKBCDEEKC-HEYVDLJRSA-N |
| XLogP | 5.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide?
The IUPAC name of (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide (CID 142058732) is (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide.
What is the SMILES notation for (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide?
The canonical SMILES for (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide is CC/C=C1/CCCC/C1=N\C1=NC2=CCCC=C2C1C.I.
What is the InChIKey of (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide?
The InChIKey is NRWIYMKBCDEEKC-HEYVDLJRSA-N. The full InChI is InChI=1S/C18H24N2.HI/c1-3-8-14-9-4-6-11-16(14)19-18-13(2)15-10-5-7-12-17(15)20-18;/h8,10,12-13H,3-7,9,11H2,1-2H3;1H/b14-8-,19-16+;.
What are the key properties of (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide?
(2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide has a molecular weight of 396.32 g/mol, XLogP of 5.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-(3-methyl-5,6-dihydro-3H-indol-2-yl)-2-propylidenecyclohexan-1-imine;hydroiodide is sourced from PubChem (CID 142058732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).