C27H44N2O4 — CID 142058786
(8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;N,N-dibutylformamide;(8R)-8-hydroxy-3-oxo-6,7-dihydro-5H-pyrrolizine-2-carbaldehyde (PubChem CID 142058786) has the molecular formula C27H44N2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;N,N-dibutylformamide;(8R)-8-hydroxy-3-oxo-6,7-dihydro-5H-pyrrolizine-2-carbaldehyde.
| Compound Name | (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;N,N-dibutylformamide;(8R)-8-hydroxy-3-oxo-6,7-dihydro-5H-pyrrolizine-2-carbaldehyde |
|---|---|
| PubChem CID | 142058786 |
| Molecular Formula | C27H44N2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;N,N-dibutylformamide;(8R)-8-hydroxy-3-oxo-6,7-dihydro-5H-pyrrolizine-2-carbaldehyde |
| SMILES | C1=C[C@H]2CCCCC2CC1.CCCCN(C=O)CCCC.O=CC1=C[C@]2(O)CCCN2C1=O |
| InChI | InChI=1S/C10H16.C9H19NO.C8H9NO3/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-5-7-10(9-11)8-6-4-2;10-5-6-4-8(12)2-1-3-9(8)7(6)11/h1,5,9-10H,2-4,6-8H2;9H,3-8H2,1-2H3;4-5,12H,1-3H2/t9-,10?;;8-/m0.1/s1 |
| InChIKey | WVEOKRZROSMOBG-AUNNKREHSA-N |
| XLogP | 4.62 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|