C23H36N2O4 — CID 142058801
(8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;2-acetyl-8-hydroxy-6,7-dihydro-5H-pyrrolizin-3-one;N-propylformamide (PubChem CID 142058801) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;2-acetyl-8-hydroxy-6,7-dihydro-5H-pyrrolizin-3-one;N-propylformamide.
| Compound Name | (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;2-acetyl-8-hydroxy-6,7-dihydro-5H-pyrrolizin-3-one;N-propylformamide |
|---|---|
| PubChem CID | 142058801 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;2-acetyl-8-hydroxy-6,7-dihydro-5H-pyrrolizin-3-one;N-propylformamide |
| SMILES | C1=C[C@H]2CCCCC2CC1.CC(=O)C1=CC2(O)CCCN2C1=O.CCCNC=O |
| InChI | InChI=1S/C10H16.C9H11NO3.C4H9NO/c1-2-6-10-8-4-3-7-9(10)5-1;1-6(11)7-5-9(13)3-2-4-10(9)8(7)12;1-2-3-5-4-6/h1,5,9-10H,2-4,6-8H2;5,13H,2-4H2,1H3;4H,2-3H2,1H3,(H,5,6)/t9-,10?;;/m0../s1 |
| InChIKey | IGPFAQXYHWQREQ-NSBDLEMJSA-N |
| XLogP | 3.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|