C24H36N2O4 — CID 142058826
(8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;(1R)-N-butyl-6-formyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 142058826) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;(1R)-N-butyl-6-formyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;(1R)-N-butyl-6-formyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 142058826 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (8aS)-1,2,3,4,4a,5,6,8a-octahydronaphthalene;(1R)-N-butyl-6-formyl-8-hydroxy-N-methyl-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | C1=C[C@H]2CCCCC2CC1.CCCCN(C)C(=O)[C@@H]1CCN2C(=O)C(C=O)=CC12O |
| InChI | InChI=1S/C14H20N2O4.C10H16/c1-3-4-6-15(2)13(19)11-5-7-16-12(18)10(9-17)8-14(11,16)20;1-2-6-10-8-4-3-7-9(10)5-1/h8-9,11,20H,3-7H2,1-2H3;1,5,9-10H,2-4,6-8H2/t11-,14?;9-,10?/m00/s1 |
| InChIKey | QQXWVALEZAHVIO-RGJRWRKQSA-N |
| XLogP | 3.06 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|