C20H33NO7 — CID 142058987
ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-formylpyrrolidine-1,2-dicarboxylate (PubChem CID 142058987) has the molecular formula C20H33NO7 and a molecular weight of 399.48 g/mol. Its IUPAC name is ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-formylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-formylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142058987 |
| Molecular Formula | C20H33NO7 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | ditert-butyl (2R,4R,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-formylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@@H](C=O)[C@H](C2COC(C)(C)O2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO7/c1-18(2,3)27-16(23)13-9-12(10-22)15(14-11-25-20(7,8)26-14)21(13)17(24)28-19(4,5)6/h10,12-15H,9,11H2,1-8H3/t12-,13+,14?,15+/m0/s1 |
| InChIKey | RRJHDFDXJZAXDB-MCBWDKPDSA-N |
| XLogP | 2.67 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|