About ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene
ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene (PubChem CID 142059048) has the molecular formula C7H9F7
and a molecular weight of 226.13 g/mol. Its IUPAC name is ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene.
Molecular Properties
| Compound Name | ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene |
| PubChem CID | 142059048 |
| Molecular Formula | C7H9F7 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene |
| SMILES | CC.CC(F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F7.C2H6/c1-2(6)3(4(7,8)9)5(10,11)12;1-2/h1H3;1-2H3 |
| InChIKey | IPMHYDNEGOYIBC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene?
The IUPAC name of ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene (CID 142059048) is ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene.
What is the SMILES notation for ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene?
The canonical SMILES for ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene is CC.CC(F)=C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene?
The InChIKey is IPMHYDNEGOYIBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F7.C2H6/c1-2(6)3(4(7,8)9)5(10,11)12;1-2/h1H3;1-2H3.
What are the key properties of ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene?
ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene has a molecular weight of 226.13 g/mol, XLogP of 4.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,1,1,3-tetrafluoro-2-(trifluoromethyl)but-2-ene is sourced from PubChem (CID 142059048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).