C25H42N2O8 — CID 142059095
ditert-butyl (2R,4S,5R)-5-[(1R,2R)-1-acetamido-4-ethoxy-2-hydroxy-4-oxobutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 142059095) has the molecular formula C25H42N2O8 and a molecular weight of 498.62 g/mol. Its IUPAC name is ditert-butyl (2R,4S,5R)-5-[(1R,2R)-1-acetamido-4-ethoxy-2-hydroxy-4-oxobutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4S,5R)-5-[(1R,2R)-1-acetamido-4-ethoxy-2-hydroxy-4-oxobutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142059095 |
| Molecular Formula | C25H42N2O8 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | ditert-butyl (2R,4S,5R)-5-[(1R,2R)-1-acetamido-4-ethoxy-2-hydroxy-4-oxobutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@@H](NC(C)=O)[C@H](O)CC(=O)OCC |
| InChI | InChI=1S/C25H42N2O8/c1-10-12-16-13-17(22(31)34-24(4,5)6)27(23(32)35-25(7,8)9)21(16)20(26-15(3)28)18(29)14-19(30)33-11-2/h10,12,16-18,20-21,29H,11,13-14H2,1-9H3,(H,26,28)/b12-10-/t16-,17-,18-,20+,21-/m1/s1 |
| InChIKey | LILQVQIONFWFHU-FGUJBFNQSA-N |
| XLogP | 2.72 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|