C19H33NO8 — CID 142059142
ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-[(1R)-1,2-dihydroxyethyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 142059142) has the molecular formula C19H33NO8 and a molecular weight of 403.47 g/mol. Its IUPAC name is ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-[(1R)-1,2-dihydroxyethyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-[(1R)-1,2-dihydroxyethyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142059142 |
| Molecular Formula | C19H33NO8 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-[(1R)-1,2-dihydroxyethyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(=O)OC[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@@H](O)CO |
| InChI | InChI=1S/C19H33NO8/c1-11(22)26-10-12-8-13(16(24)27-18(2,3)4)20(15(12)14(23)9-21)17(25)28-19(5,6)7/h12-15,21,23H,8-10H2,1-7H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | MFUOFHNMFSSHQM-LJISPDSOSA-N |
| XLogP | 1.24 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|