C17H23N3O2 — CID 142060059
6-(3,4-dimethylanilino)-3-prop-2-enyl-1H-pyrimidine-2,4-dione;ethane (PubChem CID 142060059) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6-(3,4-dimethylanilino)-3-prop-2-enyl-1H-pyrimidine-2,4-dione;ethane.
| Compound Name | 6-(3,4-dimethylanilino)-3-prop-2-enyl-1H-pyrimidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 142060059 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6-(3,4-dimethylanilino)-3-prop-2-enyl-1H-pyrimidine-2,4-dione;ethane |
| SMILES | C=CCn1c(=O)cc(Nc2ccc(C)c(C)c2)[nH]c1=O.CC |
| InChI | InChI=1S/C15H17N3O2.C2H6/c1-4-7-18-14(19)9-13(17-15(18)20)16-12-6-5-10(2)11(3)8-12;1-2/h4-6,8-9,16H,1,7H2,2-3H3,(H,17,20);1-2H3 |
| InChIKey | KEHJWRHNBUEGKA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|