C22H32N2 — CID 142060389
1-(4-methylcyclohexa-1,3-dien-1-yl)-N-[(2E,4Z)-3-methyl-6-piperidin-4-ylhepta-2,4,6-trien-2-yl]ethanimine (PubChem CID 142060389) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-1,3-dien-1-yl)-N-[(2E,4Z)-3-methyl-6-piperidin-4-ylhepta-2,4,6-trien-2-yl]ethanimine.
| Compound Name | 1-(4-methylcyclohexa-1,3-dien-1-yl)-N-[(2E,4Z)-3-methyl-6-piperidin-4-ylhepta-2,4,6-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 142060389 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-(4-methylcyclohexa-1,3-dien-1-yl)-N-[(2E,4Z)-3-methyl-6-piperidin-4-ylhepta-2,4,6-trien-2-yl]ethanimine |
| SMILES | C=C(/C=C\C(C)=C(C)\N=C(/C)C1=CC=C(C)CC1)C1CCNCC1 |
| InChI | InChI=1S/C22H32N2/c1-16-6-10-22(11-7-16)20(5)24-19(4)17(2)8-9-18(3)21-12-14-23-15-13-21/h6,8-10,21,23H,3,7,11-15H2,1-2,4-5H3/b9-8-,19-17+,24-20+ |
| InChIKey | WXNLVBYICLMXSV-FWMPGXLUSA-N |
| XLogP | 5.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|