C13H14N2O5 — CID 142060411
ethyl 3-(2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3-oxopropanoate (PubChem CID 142060411) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is ethyl 3-(2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-(2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 142060411 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl 3-(2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1ccc2c(n1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C13H14N2O5/c1-3-19-11(17)6-9(16)8-4-5-10-12(14-8)15-13(18)7(2)20-10/h4-5,7H,3,6H2,1-2H3,(H,14,15,18) |
| InChIKey | CBMVVUODZOXXSD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|