C19H25N5OS — CID 142060763
4-[3-[(E)-2-(4-cyclobutyl-1,3-thiazol-2-yl)ethenyl]phenoxy]-N'-hydrazinylbutanimidamide (PubChem CID 142060763) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 4-[3-[(E)-2-(4-cyclobutyl-1,3-thiazol-2-yl)ethenyl]phenoxy]-N'-hydrazinylbutanimidamide.
| Compound Name | 4-[3-[(E)-2-(4-cyclobutyl-1,3-thiazol-2-yl)ethenyl]phenoxy]-N'-hydrazinylbutanimidamide |
|---|---|
| PubChem CID | 142060763 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-[3-[(E)-2-(4-cyclobutyl-1,3-thiazol-2-yl)ethenyl]phenoxy]-N'-hydrazinylbutanimidamide |
| SMILES | NN/N=C(\N)CCCOc1cccc(/C=C/c2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C19H25N5OS/c20-18(23-24-21)8-3-11-25-16-7-1-4-14(12-16)9-10-19-22-17(13-26-19)15-5-2-6-15/h1,4,7,9-10,12-13,15,24H,2-3,5-6,8,11,21H2,(H2,20,23)/b10-9+ |
| InChIKey | SZBAMOJHSQETBX-MDZDMXLPSA-N |
| XLogP | 3.48 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|