C14H21N3S — CID 142061111
(2Z)-2-[amino-[[(3Z,5Z)-hepta-1,3,5-trienyl]amino]methylidene]-N,3-dimethylbut-3-enethioamide (PubChem CID 142061111) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is (2Z)-2-[amino-[[(3Z,5Z)-hepta-1,3,5-trienyl]amino]methylidene]-N,3-dimethylbut-3-enethioamide.
| Compound Name | (2Z)-2-[amino-[[(3Z,5Z)-hepta-1,3,5-trienyl]amino]methylidene]-N,3-dimethylbut-3-enethioamide |
|---|---|
| PubChem CID | 142061111 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2Z)-2-[amino-[[(3Z,5Z)-hepta-1,3,5-trienyl]amino]methylidene]-N,3-dimethylbut-3-enethioamide |
| SMILES | C=C(C)/C(C(=S)NC)=C(\N)NC=C/C=C\C=C/C |
| InChI | InChI=1S/C14H21N3S/c1-5-6-7-8-9-10-17-13(15)12(11(2)3)14(18)16-4/h5-10,17H,2,15H2,1,3-4H3,(H,16,18)/b6-5-,8-7-,10-9?,13-12- |
| InChIKey | CZNXCDUFKPYHAY-WGEXODBWSA-N |
| XLogP | 2.52 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|