About ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene
ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene (PubChem CID 142061699) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene.
Molecular Properties
| Compound Name | ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene |
| PubChem CID | 142061699 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene |
| SMILES | C=C/C=C(\C=C/OC)CCC.CC |
| InChI | InChI=1S/C10H16O.C2H6/c1-4-6-10(7-5-2)8-9-11-3;1-2/h4,6,8-9H,1,5,7H2,2-3H3;1-2H3/b9-8-,10-6-; |
| InChIKey | SGVZNCSQLRCFKZ-BCGYUPIMSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene?
The IUPAC name of ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene (CID 142061699) is ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene.
What is the SMILES notation for ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene?
The canonical SMILES for ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene is C=C/C=C(\C=C/OC)CCC.CC.
What is the InChIKey of ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene?
The InChIKey is SGVZNCSQLRCFKZ-BCGYUPIMSA-N. The full InChI is InChI=1S/C10H16O.C2H6/c1-4-6-10(7-5-2)8-9-11-3;1-2/h4,6,8-9H,1,5,7H2,2-3H3;1-2H3/b9-8-,10-6-;.
What are the key properties of ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene?
ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene has a molecular weight of 182.31 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-4-[(Z)-2-methoxyethenyl]hepta-1,3-diene is sourced from PubChem (CID 142061699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).