About butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine
butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine (PubChem CID 142061860) has the molecular formula C13H29NS
and a molecular weight of 231.45 g/mol. Its IUPAC name is butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine.
Molecular Properties
| Compound Name | butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine |
| PubChem CID | 142061860 |
| Molecular Formula | C13H29NS |
| Molecular Weight | 231.45 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine |
| SMILES | CC(C)=NC(C)=C(C)C.CCCC.CS |
| InChI | InChI=1S/C8H15N.C4H10.CH4S/c1-6(2)8(5)9-7(3)4;1-3-4-2;1-2/h1-5H3;3-4H2,1-2H3;2H,1H3 |
| InChIKey | WKLFHFLBSOCRGY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 231.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine?
The IUPAC name of butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine (CID 142061860) is butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine.
What is the SMILES notation for butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine?
The canonical SMILES for butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine is CC(C)=NC(C)=C(C)C.CCCC.CS.
What is the InChIKey of butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine?
The InChIKey is WKLFHFLBSOCRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C4H10.CH4S/c1-6(2)8(5)9-7(3)4;1-3-4-2;1-2/h1-5H3;3-4H2,1-2H3;2H,1H3.
What are the key properties of butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine?
butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine has a molecular weight of 231.45 g/mol, XLogP of 5.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;methanethiol;N-(3-methylbut-2-en-2-yl)propan-2-imine is sourced from PubChem (CID 142061860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).