About N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide
N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide (PubChem CID 142061924) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide.
Molecular Properties
| Compound Name | N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide |
| PubChem CID | 142061924 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide |
| SMILES | ON/C=N/c1ccc2c(c1)NNN2 |
| InChI | InChI=1S/C7H9N5O/c13-9-4-8-5-1-2-6-7(3-5)11-12-10-6/h1-4,10-13H,(H,8,9) |
| InChIKey | QBXFIJZEESQLHJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide?
The IUPAC name of N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide (CID 142061924) is N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide.
What is the SMILES notation for N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide?
The canonical SMILES for N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide is ON/C=N/c1ccc2c(c1)NNN2.
What is the InChIKey of N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide?
The InChIKey is QBXFIJZEESQLHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c13-9-4-8-5-1-2-6-7(3-5)11-12-10-6/h1-4,10-13H,(H,8,9).
What are the key properties of N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide?
N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide has a molecular weight of 179.18 g/mol, XLogP of 0.58, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-hydroxymethanimidamide is sourced from PubChem (CID 142061924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).