C35H40FN5O5S — CID 142062751
4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(3E)-3-fluoro-2-methylidenehexa-3,5-dienyl]cyclohexane-1-carboxamide (PubChem CID 142062751) has the molecular formula C35H40FN5O5S and a molecular weight of 661.80 g/mol. Its IUPAC name is 4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(3E)-3-fluoro-2-methylidenehexa-3,5-dienyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(3E)-3-fluoro-2-methylidenehexa-3,5-dienyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142062751 |
| Molecular Formula | C35H40FN5O5S |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | 4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(3E)-3-fluoro-2-methylidenehexa-3,5-dienyl]cyclohexane-1-carboxamide |
| SMILES | C=C/C=C(/F)C(=C)CNC(=O)C1CCC(Cc2nc3ccc(NS(=O)(=O)CCCCCN4C(=O)c5ccccc5C4=O)cc3[nH]2)CC1 |
| InChI | InChI=1S/C35H40FN5O5S/c1-3-9-29(36)23(2)22-37-33(42)25-14-12-24(13-15-25)20-32-38-30-17-16-26(21-31(30)39-32)40-47(45,46)19-8-4-7-18-41-34(43)27-10-5-6-11-28(27)35(41)44/h3,5-6,9-11,16-17,21,24-25,40H,1-2,4,7-8,12-15,18-20,22H2,(H,37,42)(H,38,39)/b29-9+ |
| InChIKey | JATBSFRYKLKUEW-GESPGMLMSA-N |
| XLogP | 5.83 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|