About 4-chloro-1-methylindole;ethane
4-chloro-1-methylindole;ethane (PubChem CID 142062846) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 4-chloro-1-methylindole;ethane.
Molecular Properties
| Compound Name | 4-chloro-1-methylindole;ethane |
| PubChem CID | 142062846 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-chloro-1-methylindole;ethane |
| SMILES | CC.Cn1ccc2c(Cl)cccc21 |
| InChI | InChI=1S/C9H8ClN.C2H6/c1-11-6-5-7-8(10)3-2-4-9(7)11;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | QWMZGQYBEKMBIT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-1-methylindole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-methylindole;ethane?
The IUPAC name of 4-chloro-1-methylindole;ethane (CID 142062846) is 4-chloro-1-methylindole;ethane.
What is the SMILES notation for 4-chloro-1-methylindole;ethane?
The canonical SMILES for 4-chloro-1-methylindole;ethane is CC.Cn1ccc2c(Cl)cccc21.
What is the InChIKey of 4-chloro-1-methylindole;ethane?
The InChIKey is QWMZGQYBEKMBIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN.C2H6/c1-11-6-5-7-8(10)3-2-4-9(7)11;1-2/h2-6H,1H3;1-2H3.
What are the key properties of 4-chloro-1-methylindole;ethane?
4-chloro-1-methylindole;ethane has a molecular weight of 195.69 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-methylindole;ethane is sourced from PubChem (CID 142062846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).