About N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine
N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine (PubChem CID 142062864) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine |
| PubChem CID | 142062864 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine |
| SMILES | CN(C)C1OC=C2C=CC=CC21 |
| InChI | InChI=1S/C10H13NO/c1-11(2)10-9-6-4-3-5-8(9)7-12-10/h3-7,9-10H,1-2H3 |
| InChIKey | OABKCNQOPNAFJT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine?
The IUPAC name of N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine (CID 142062864) is N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine.
What is the SMILES notation for N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine?
The canonical SMILES for N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine is CN(C)C1OC=C2C=CC=CC21.
What is the InChIKey of N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine?
The InChIKey is OABKCNQOPNAFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-11(2)10-9-6-4-3-5-8(9)7-12-10/h3-7,9-10H,1-2H3.
What are the key properties of N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine?
N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine has a molecular weight of 163.22 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,7a-dihydro-2-benzofuran-1-amine is sourced from PubChem (CID 142062864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).