About 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one
6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one (PubChem CID 142063231) has the molecular formula C27H34N4O4
and a molecular weight of 478.59 g/mol. Its IUPAC name is 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one |
| PubChem CID | 142063231 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one |
| SMILES | Cc1ccc(-c2ccc(=O)[nH]c2)cc1.O=CNCCCCCC(=O)O.[H]/N=C(\N)c1cccc(C)c1 |
| InChI | InChI=1S/C12H11NO.C8H10N2.C7H13NO3/c1-9-2-4-10(5-3-9)11-6-7-12(14)13-8-11;1-6-3-2-4-7(5-6)8(9)10;9-6-8-5-3-1-2-4-7(10)11/h2-8H,1H3,(H,13,14);2-5H,1H3,(H3,9,10);6H,1-5H2,(H,8,9)(H,10,11) |
| InChIKey | ZXHCFAHYCSBXPJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one?
The IUPAC name of 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one (CID 142063231) is 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one.
What is the SMILES notation for 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one?
The canonical SMILES for 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one is Cc1ccc(-c2ccc(=O)[nH]c2)cc1.O=CNCCCCCC(=O)O.[H]/N=C(\N)c1cccc(C)c1.
What is the InChIKey of 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one?
The InChIKey is ZXHCFAHYCSBXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.C8H10N2.C7H13NO3/c1-9-2-4-10(5-3-9)11-6-7-12(14)13-8-11;1-6-3-2-4-7(5-6)8(9)10;9-6-8-5-3-1-2-4-7(10)11/h2-8H,1H3,(H,13,14);2-5H,1H3,(H3,9,10);6H,1-5H2,(H,8,9)(H,10,11).
What are the key properties of 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one?
6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one has a molecular weight of 478.59 g/mol, XLogP of 4.01, 9 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-formamidohexanoic acid;3-methylbenzenecarboximidamide;5-(4-methylphenyl)-1H-pyridin-2-one is sourced from PubChem (CID 142063231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).