C19H24N6S2 — CID 142063374
2-[3-(benzimidazol-1-ylmethyl)-2-methylphenyl]sulfanylethyl N-hydrazinyl-N'-methylcarbamimidothioate (PubChem CID 142063374) has the molecular formula C19H24N6S2 and a molecular weight of 400.58 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-ylmethyl)-2-methylphenyl]sulfanylethyl N-hydrazinyl-N'-methylcarbamimidothioate.
| Compound Name | 2-[3-(benzimidazol-1-ylmethyl)-2-methylphenyl]sulfanylethyl N-hydrazinyl-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 142063374 |
| Molecular Formula | C19H24N6S2 |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[3-(benzimidazol-1-ylmethyl)-2-methylphenyl]sulfanylethyl N-hydrazinyl-N'-methylcarbamimidothioate |
| SMILES | C/N=C(\NNN)SCCSc1cccc(Cn2cnc3ccccc32)c1C |
| InChI | InChI=1S/C19H24N6S2/c1-14-15(12-25-13-22-16-7-3-4-8-17(16)25)6-5-9-18(14)26-10-11-27-19(21-2)23-24-20/h3-9,13,24H,10-12,20H2,1-2H3,(H,21,23) |
| InChIKey | LBIDWLSDUKSEIX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|