C12H19NO2 — CID 142063671
1-(3-ethoxy-4-methoxyphenyl)-N,N-dimethylmethanamine (PubChem CID 142063671) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methoxyphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(3-ethoxy-4-methoxyphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 142063671 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(3-ethoxy-4-methoxyphenyl)-N,N-dimethylmethanamine |
| SMILES | CCOc1cc(CN(C)C)ccc1OC |
| InChI | InChI=1S/C12H19NO2/c1-5-15-12-8-10(9-13(2)3)6-7-11(12)14-4/h6-8H,5,9H2,1-4H3 |
| InChIKey | WUCFTKQRAGHZFU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |