About N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene
N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene (PubChem CID 142065089) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene.
Molecular Properties
| Compound Name | N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene |
| PubChem CID | 142065089 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene |
| SMILES | CCCc1ccc(CCCc2ccccc2)cc1.O=CNO |
| InChI | InChI=1S/C18H22.CH3NO2/c1-2-7-16-12-14-18(15-13-16)11-6-10-17-8-4-3-5-9-17;3-1-2-4/h3-5,8-9,12-15H,2,6-7,10-11H2,1H3;1,4H,(H,2,3) |
| InChIKey | JJXDKXUYAUFUPE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene?
The IUPAC name of N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene (CID 142065089) is N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene.
What is the SMILES notation for N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene?
The canonical SMILES for N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene is CCCc1ccc(CCCc2ccccc2)cc1.O=CNO.
What is the InChIKey of N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene?
The InChIKey is JJXDKXUYAUFUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22.CH3NO2/c1-2-7-16-12-14-18(15-13-16)11-6-10-17-8-4-3-5-9-17;3-1-2-4/h3-5,8-9,12-15H,2,6-7,10-11H2,1H3;1,4H,(H,2,3).
What are the key properties of N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene?
N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene has a molecular weight of 299.41 g/mol, XLogP of 3.94, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyformamide;1-(3-phenylpropyl)-4-propylbenzene is sourced from PubChem (CID 142065089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).