C25H49NO2 — CID 142065237
ethane;(1E,3E)-6-(5-ethylidenenonan-2-ylamino)-4-[(Z)-prop-1-enyl]hepta-1,3-diene-1,5-diol (PubChem CID 142065237) has the molecular formula C25H49NO2 and a molecular weight of 395.67 g/mol. Its IUPAC name is ethane;(1E,3E)-6-(5-ethylidenenonan-2-ylamino)-4-[(Z)-prop-1-enyl]hepta-1,3-diene-1,5-diol.
| Compound Name | ethane;(1E,3E)-6-(5-ethylidenenonan-2-ylamino)-4-[(Z)-prop-1-enyl]hepta-1,3-diene-1,5-diol |
|---|---|
| PubChem CID | 142065237 |
| Molecular Formula | C25H49NO2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.38 |
| IUPAC Name | ethane;(1E,3E)-6-(5-ethylidenenonan-2-ylamino)-4-[(Z)-prop-1-enyl]hepta-1,3-diene-1,5-diol |
| SMILES | CC.CC.CC=C(CCCC)CCC(C)NC(C)C(O)C(/C=C\C)=C/C=C/O |
| InChI | InChI=1S/C21H37NO2.2C2H6/c1-6-9-12-19(8-3)15-14-17(4)22-18(5)21(24)20(11-7-2)13-10-16-23;2*1-2/h7-8,10-11,13,16-18,21-24H,6,9,12,14-15H2,1-5H3;2*1-2H3/b11-7-,16-10+,19-8?,20-13+;; |
| InChIKey | RIULHYMQMWLTSQ-PZFHGLDXSA-N |
| XLogP | 7.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|