C20H21ClIN — CID 142066431
4-[2-(2-chlorophenyl)ethenyl]-2-ethyl-5,5-dimethyl-3λ3-ioda-2-azabicyclo[4.4.0]deca-1(10),3,6,8-tetraene (PubChem CID 142066431) has the molecular formula C20H21ClIN and a molecular weight of 437.75 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)ethenyl]-2-ethyl-5,5-dimethyl-3λ3-ioda-2-azabicyclo[4.4.0]deca-1(10),3,6,8-tetraene.
| Compound Name | 4-[2-(2-chlorophenyl)ethenyl]-2-ethyl-5,5-dimethyl-3λ3-ioda-2-azabicyclo[4.4.0]deca-1(10),3,6,8-tetraene |
|---|---|
| PubChem CID | 142066431 |
| Molecular Formula | C20H21ClIN |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 4-[2-(2-chlorophenyl)ethenyl]-2-ethyl-5,5-dimethyl-3λ3-ioda-2-azabicyclo[4.4.0]deca-1(10),3,6,8-tetraene |
| SMILES | CCN1I=C(C=Cc2ccccc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H21ClIN/c1-4-23-18-12-8-6-10-16(18)20(2,3)19(22-23)14-13-15-9-5-7-11-17(15)21/h5-14H,4H2,1-3H3 |
| InChIKey | NSGQBJNJGYTYJG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|