C20H34N4O3 — CID 142066613
(3S)-3-(4-aminobutyl)-9-pent-4-enoyl-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 142066613) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is (3S)-3-(4-aminobutyl)-9-pent-4-enoyl-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3S)-3-(4-aminobutyl)-9-pent-4-enoyl-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 142066613 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (3S)-3-(4-aminobutyl)-9-pent-4-enoyl-1-propyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | C=CCCC(=O)N1CCC2(CC1)C(=O)N[C@@H](CCCCN)C(=O)N2CCC |
| InChI | InChI=1S/C20H34N4O3/c1-3-5-9-17(25)23-14-10-20(11-15-23)19(27)22-16(8-6-7-12-21)18(26)24(20)13-4-2/h3,16H,1,4-15,21H2,2H3,(H,22,27)/t16-/m0/s1 |
| InChIKey | LCVFLHMEOUGSJI-INIZCTEOSA-N |
| XLogP | 1.18 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|