C13H20FN — CID 142066618
(3E,4Z)-N-butyl-3-ethylidene-6-fluorohepta-1,4,6-trien-2-amine (PubChem CID 142066618) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is (3E,4Z)-N-butyl-3-ethylidene-6-fluorohepta-1,4,6-trien-2-amine.
| Compound Name | (3E,4Z)-N-butyl-3-ethylidene-6-fluorohepta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142066618 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (3E,4Z)-N-butyl-3-ethylidene-6-fluorohepta-1,4,6-trien-2-amine |
| SMILES | C=C(F)/C=C\C(=C/C)C(=C)NCCCC |
| InChI | InChI=1S/C13H20FN/c1-5-7-10-15-12(4)13(6-2)9-8-11(3)14/h6,8-9,15H,3-5,7,10H2,1-2H3/b9-8-,13-6+ |
| InChIKey | DZNDYNONPWSLMI-GFBXJKNCSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|