About ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione
ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 142067519) has the molecular formula C10H15F3N2O2
and a molecular weight of 252.24 g/mol. Its IUPAC name is ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| PubChem CID | 142067519 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC.Cc1c(C(F)(F)F)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H9F3N2O2.C2H6/c1-4-5(8(9,10)11)12(2)7(15)13(3)6(4)14;1-2/h1-3H3;1-2H3 |
| InChIKey | SQIDGCVYRLCKGZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The IUPAC name of ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione (CID 142067519) is ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
What is the SMILES notation for ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The canonical SMILES for ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione is CC.Cc1c(C(F)(F)F)n(C)c(=O)n(C)c1=O.
What is the InChIKey of ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
The InChIKey is SQIDGCVYRLCKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2.C2H6/c1-4-5(8(9,10)11)12(2)7(15)13(3)6(4)14;1-2/h1-3H3;1-2H3.
What are the key properties of ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione?
ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione has a molecular weight of 252.24 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,3,5-trimethyl-6-(trifluoromethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 142067519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).