C19H23NO2 — CID 142067637
3,4-bis(ethenyl)-1-(1-phenylpropan-2-yl)pyrrole-2,5-dione;ethane (PubChem CID 142067637) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1-(1-phenylpropan-2-yl)pyrrole-2,5-dione;ethane.
| Compound Name | 3,4-bis(ethenyl)-1-(1-phenylpropan-2-yl)pyrrole-2,5-dione;ethane |
|---|---|
| PubChem CID | 142067637 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3,4-bis(ethenyl)-1-(1-phenylpropan-2-yl)pyrrole-2,5-dione;ethane |
| SMILES | C=CC1=C(C=C)C(=O)N(C(C)Cc2ccccc2)C1=O.CC |
| InChI | InChI=1S/C17H17NO2.C2H6/c1-4-14-15(5-2)17(20)18(16(14)19)12(3)11-13-9-7-6-8-10-13;1-2/h4-10,12H,1-2,11H2,3H3;1-2H3 |
| InChIKey | HHPYHKOVLQCXES-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|