C27H33N5O7 — CID 142067669
(4R)-5-[5-[amino(methylamino)methyl]-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[(1-pyridin-4-yl-3,6-dihydro-2H-pyridine-5-carbonyl)amino]pentanoic acid (PubChem CID 142067669) has the molecular formula C27H33N5O7 and a molecular weight of 539.59 g/mol. Its IUPAC name is (4R)-5-[5-[amino(methylamino)methyl]-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[(1-pyridin-4-yl-3,6-dihydro-2H-pyridine-5-carbonyl)amino]pentanoic acid.
| Compound Name | (4R)-5-[5-[amino(methylamino)methyl]-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[(1-pyridin-4-yl-3,6-dihydro-2H-pyridine-5-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 142067669 |
| Molecular Formula | C27H33N5O7 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (4R)-5-[5-[amino(methylamino)methyl]-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[(1-pyridin-4-yl-3,6-dihydro-2H-pyridine-5-carbonyl)amino]pentanoic acid |
| SMILES | CNC(N)c1ccc(CC(=O)C(=O)O)c(OC[C@@H](CCC(=O)O)NC(=O)C2=CCCN(c3ccncc3)C2)c1 |
| InChI | InChI=1S/C27H33N5O7/c1-29-25(28)18-5-4-17(13-22(33)27(37)38)23(14-18)39-16-20(6-7-24(34)35)31-26(36)19-3-2-12-32(15-19)21-8-10-30-11-9-21/h3-5,8-11,14,20,25,29H,2,6-7,12-13,15-16,28H2,1H3,(H,31,36)(H,34,35)(H,37,38)/t20-,25?/m1/s1 |
| InChIKey | QYDJMCXFXNSDOX-VGOKPJQXSA-N |
| XLogP | 1.02 |
| TPSA | 184.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|