C16H32N2 — CID 142067711
methane;(Z)-1-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]hept-5-ene-1,3-diamine;molecular hydrogen (PubChem CID 142067711) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is methane;(Z)-1-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]hept-5-ene-1,3-diamine;molecular hydrogen.
| Compound Name | methane;(Z)-1-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]hept-5-ene-1,3-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 142067711 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | methane;(Z)-1-N-[(4-methylcyclohexa-1,3-dien-1-yl)methyl]hept-5-ene-1,3-diamine;molecular hydrogen |
| SMILES | C.C/C=C\CC(N)CCNCC1=CC=C(C)CC1.[H][H] |
| InChI | InChI=1S/C15H26N2.CH4.H2/c1-3-4-5-15(16)10-11-17-12-14-8-6-13(2)7-9-14;;/h3-4,6,8,15,17H,5,7,9-12,16H2,1-2H3;1H4;1H/b4-3-;; |
| InChIKey | ZTDVJEPPMDOBBW-GSBNXNDCSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|