About ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine
ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine (PubChem CID 142067927) has the molecular formula C18H42N2O
and a molecular weight of 302.55 g/mol. Its IUPAC name is ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine.
Molecular Properties
| Compound Name | ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine |
| PubChem CID | 142067927 |
| Molecular Formula | C18H42N2O |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.33 |
| IUPAC Name | ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine |
| SMILES | CC.CC.CC=C(C)C.CCCN(C)CC1COCCN1 |
| InChI | InChI=1S/C9H20N2O.C5H10.2C2H6/c1-3-5-11(2)7-9-8-12-6-4-10-9;1-4-5(2)3;2*1-2/h9-10H,3-8H2,1-2H3;4H,1-3H3;2*1-2H3 |
| InChIKey | LNAKCRZZUFNTEW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine?
The IUPAC name of ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine (CID 142067927) is ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine.
What is the SMILES notation for ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine?
The canonical SMILES for ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine is CC.CC.CC=C(C)C.CCCN(C)CC1COCCN1.
What is the InChIKey of ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine?
The InChIKey is LNAKCRZZUFNTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O.C5H10.2C2H6/c1-3-5-11(2)7-9-8-12-6-4-10-9;1-4-5(2)3;2*1-2/h9-10H,3-8H2,1-2H3;4H,1-3H3;2*1-2H3.
What are the key properties of ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine?
ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine has a molecular weight of 302.55 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbut-2-ene;N-methyl-N-(morpholin-3-ylmethyl)propan-1-amine is sourced from PubChem (CID 142067927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).