About ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine
ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine (PubChem CID 142068067) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine |
| PubChem CID | 142068067 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine |
| SMILES | CC.CC=C(C)C.CCCN(C)CC1CCCN(C)C1 |
| InChI | InChI=1S/C11H24N2.C5H10.C2H6/c1-4-7-12(2)9-11-6-5-8-13(3)10-11;1-4-5(2)3;1-2/h11H,4-10H2,1-3H3;4H,1-3H3;1-2H3 |
| InChIKey | CSKOLKGJKXDZHD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine?
The IUPAC name of ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine (CID 142068067) is ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine.
What is the SMILES notation for ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine?
The canonical SMILES for ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine is CC.CC=C(C)C.CCCN(C)CC1CCCN(C)C1.
What is the InChIKey of ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine?
The InChIKey is CSKOLKGJKXDZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2.C5H10.C2H6/c1-4-7-12(2)9-11-6-5-8-13(3)10-11;1-4-5(2)3;1-2/h11H,4-10H2,1-3H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine?
ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine has a molecular weight of 284.53 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbut-2-ene;N-methyl-N-[(1-methylpiperidin-3-yl)methyl]propan-1-amine is sourced from PubChem (CID 142068067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).