About 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine
6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine (PubChem CID 142068853) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine.
Molecular Properties
| Compound Name | 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine |
| PubChem CID | 142068853 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine |
| SMILES | CNCCCCCCOC1=CC=CCC1OC |
| InChI | InChI=1S/C14H25NO2/c1-15-11-7-3-4-8-12-17-14-10-6-5-9-13(14)16-2/h5-6,10,13,15H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | WXMHQWLBBRJJTG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine?
The IUPAC name of 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine (CID 142068853) is 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine.
What is the SMILES notation for 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine?
The canonical SMILES for 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine is CNCCCCCCOC1=CC=CCC1OC.
What is the InChIKey of 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine?
The InChIKey is WXMHQWLBBRJJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-15-11-7-3-4-8-12-17-14-10-6-5-9-13(14)16-2/h5-6,10,13,15H,3-4,7-9,11-12H2,1-2H3.
What are the key properties of 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine?
6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine has a molecular weight of 239.36 g/mol, XLogP of 2.64, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-methoxycyclohexa-1,3-dien-1-yl)oxy-N-methylhexan-1-amine is sourced from PubChem (CID 142068853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).