C18H23NO3S2 — CID 142069269
(E)-4-methyl-2-(4-methylsulfonylphenyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]pent-2-enamide (PubChem CID 142069269) has the molecular formula C18H23NO3S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (E)-4-methyl-2-(4-methylsulfonylphenyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]pent-2-enamide.
| Compound Name | (E)-4-methyl-2-(4-methylsulfonylphenyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]pent-2-enamide |
|---|---|
| PubChem CID | 142069269 |
| Molecular Formula | C18H23NO3S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (E)-4-methyl-2-(4-methylsulfonylphenyl)-N-[1-[(Z)-prop-1-enyl]sulfanylethenyl]pent-2-enamide |
| SMILES | C=C(NC(=O)/C(=C/C(C)C)c1ccc(S(C)(=O)=O)cc1)S/C=C\C |
| InChI | InChI=1S/C18H23NO3S2/c1-6-11-23-14(4)19-18(20)17(12-13(2)3)15-7-9-16(10-8-15)24(5,21)22/h6-13H,4H2,1-3,5H3,(H,19,20)/b11-6-,17-12+ |
| InChIKey | VTCSXTATNCTRSA-AVPCUTKJSA-N |
| XLogP | 3.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|