About 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one
4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one (PubChem CID 142069496) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one.
Molecular Properties
| Compound Name | 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one |
| PubChem CID | 142069496 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one |
| SMILES | CCC1=CC(=O)Cc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H16O3/c1-4-9-5-11(15)6-10-7-13(16-2)14(17-3)8-12(9)10/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | ANHBVIAXORRNDK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one?
The IUPAC name of 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one (CID 142069496) is 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one.
What is the SMILES notation for 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one?
The canonical SMILES for 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one is CCC1=CC(=O)Cc2cc(OC)c(OC)cc21.
What is the InChIKey of 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one?
The InChIKey is ANHBVIAXORRNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c1-4-9-5-11(15)6-10-7-13(16-2)14(17-3)8-12(9)10/h5,7-8H,4,6H2,1-3H3.
What are the key properties of 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one?
4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one has a molecular weight of 232.28 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6,7-dimethoxy-1H-naphthalen-2-one is sourced from PubChem (CID 142069496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).