About (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide
(6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide (PubChem CID 142069658) has the molecular formula C7H7N2-
and a molecular weight of 119.15 g/mol. Its IUPAC name is (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide.
Molecular Properties
| Compound Name | (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide |
| PubChem CID | 142069658 |
| Molecular Formula | C7H7N2- |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide |
| SMILES | [H]/N=C1\C=C(C)C=CC1=[N-] |
| InChI | InChI=1S/C7H7N2/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3/q-1/b9-7+ |
| InChIKey | NGSOPGKEXWXWJX-VQHVLOKHSA-N |
| XLogP | 1.53 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide?
The IUPAC name of (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide (CID 142069658) is (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide.
What is the SMILES notation for (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide?
The canonical SMILES for (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide is [H]/N=C1\C=C(C)C=CC1=[N-].
What is the InChIKey of (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide?
The InChIKey is NGSOPGKEXWXWJX-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H7N2/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3/q-1/b9-7+.
What are the key properties of (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide?
(6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide has a molecular weight of 119.15 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-imino-4-methylcyclohexa-2,4-dien-1-ylidene)azanide is sourced from PubChem (CID 142069658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).