C18H24N2S — CID 142069998
N-[(1E,3E,4Z)-3-ethylidene-2-methylhepta-1,4,6-trienyl]-4-(2-methyl-1,3-thiazol-5-yl)butan-2-imine (PubChem CID 142069998) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is N-[(1E,3E,4Z)-3-ethylidene-2-methylhepta-1,4,6-trienyl]-4-(2-methyl-1,3-thiazol-5-yl)butan-2-imine.
| Compound Name | N-[(1E,3E,4Z)-3-ethylidene-2-methylhepta-1,4,6-trienyl]-4-(2-methyl-1,3-thiazol-5-yl)butan-2-imine |
|---|---|
| PubChem CID | 142069998 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[(1E,3E,4Z)-3-ethylidene-2-methylhepta-1,4,6-trienyl]-4-(2-methyl-1,3-thiazol-5-yl)butan-2-imine |
| SMILES | C=C/C=C\C(=C/C)\C(C)=C\N=C(/C)CCc1cnc(C)s1 |
| InChI | InChI=1S/C18H24N2S/c1-6-8-9-17(7-2)14(3)12-19-15(4)10-11-18-13-20-16(5)21-18/h6-9,12-13H,1,10-11H2,2-5H3/b9-8-,14-12+,17-7+,19-15+ |
| InChIKey | NPEBGGPBEUZZGE-WHFBYRLWSA-N |
| XLogP | 5.44 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|