About 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole
5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole (PubChem CID 142070055) has the molecular formula C10H12N2OS2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole |
| PubChem CID | 142070055 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole |
| SMILES | CCc1cnc(CSc2cnc(C)s2)o1 |
| InChI | InChI=1S/C10H12N2OS2/c1-3-8-4-12-9(13-8)6-14-10-5-11-7(2)15-10/h4-5H,3,6H2,1-2H3 |
| InChIKey | UYVDNESAPCRKBB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole?
The IUPAC name of 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole (CID 142070055) is 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole.
What is the SMILES notation for 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole?
The canonical SMILES for 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole is CCc1cnc(CSc2cnc(C)s2)o1.
What is the InChIKey of 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole?
The InChIKey is UYVDNESAPCRKBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS2/c1-3-8-4-12-9(13-8)6-14-10-5-11-7(2)15-10/h4-5H,3,6H2,1-2H3.
What are the key properties of 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole?
5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole has a molecular weight of 240.35 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfanylmethyl]-1,3-oxazole is sourced from PubChem (CID 142070055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).