About N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole
N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole (PubChem CID 142070569) has the molecular formula C24H30F3N3
and a molecular weight of 417.52 g/mol. Its IUPAC name is N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole.
Molecular Properties
| Compound Name | N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole |
| PubChem CID | 142070569 |
| Molecular Formula | C24H30F3N3 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole |
| SMILES | CCCCN(CCC)c1ccccc1.Cc1ncc(-c2cccc(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C13H21N.C11H9F3N2/c1-3-5-12-14(11-4-2)13-9-7-6-8-10-13;1-7-15-6-10(16-7)8-3-2-4-9(5-8)11(12,13)14/h6-10H,3-5,11-12H2,1-2H3;2-6H,1H3,(H,15,16) |
| InChIKey | ORKNAYKCVDLBFG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole?
The IUPAC name of N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole (CID 142070569) is N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole.
What is the SMILES notation for N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole?
The canonical SMILES for N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole is CCCCN(CCC)c1ccccc1.Cc1ncc(-c2cccc(C(F)(F)F)c2)[nH]1.
What is the InChIKey of N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole?
The InChIKey is ORKNAYKCVDLBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N.C11H9F3N2/c1-3-5-12-14(11-4-2)13-9-7-6-8-10-13;1-7-15-6-10(16-7)8-3-2-4-9(5-8)11(12,13)14/h6-10H,3-5,11-12H2,1-2H3;2-6H,1H3,(H,15,16).
What are the key properties of N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole?
N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole has a molecular weight of 417.52 g/mol, XLogP of 7.11, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-propylaniline;2-methyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole is sourced from PubChem (CID 142070569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).