About N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate
N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate (PubChem CID 142070605) has the molecular formula C22H41NO
and a molecular weight of 335.58 g/mol. Its IUPAC name is N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate.
Molecular Properties
| Compound Name | N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate |
| PubChem CID | 142070605 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate |
| SMILES | CCC.CCCN(CC)CCC=CCc1cccc(C(C)C)c1.O |
| InChI | InChI=1S/C19H31N.C3H8.H2O/c1-5-14-20(6-2)15-9-7-8-11-18-12-10-13-19(16-18)17(3)4;1-3-2;/h7-8,10,12-13,16-17H,5-6,9,11,14-15H2,1-4H3;3H2,1-2H3;1H2 |
| InChIKey | NZIFCEWNHSXNQO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate?
The IUPAC name of N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate (CID 142070605) is N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate.
What is the SMILES notation for N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate?
The canonical SMILES for N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate is CCC.CCCN(CC)CCC=CCc1cccc(C(C)C)c1.O.
What is the InChIKey of N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate?
The InChIKey is NZIFCEWNHSXNQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N.C3H8.H2O/c1-5-14-20(6-2)15-9-7-8-11-18-12-10-13-19(16-18)17(3)4;1-3-2;/h7-8,10,12-13,16-17H,5-6,9,11,14-15H2,1-4H3;3H2,1-2H3;1H2.
What are the key properties of N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate?
N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate has a molecular weight of 335.58 g/mol, XLogP of 5.62, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-(3-propan-2-ylphenyl)-N-propylpent-3-en-1-amine;propane;hydrate is sourced from PubChem (CID 142070605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).