C31H52N4O — CID 142070720
1-[1-[2-aminoprop-2-enyl(2-cyclopentylethyl)amino]ethenyl]-N-(4-methylphenyl)pyrrolidine-2-carboxamide;heptane (PubChem CID 142070720) has the molecular formula C31H52N4O and a molecular weight of 496.78 g/mol. Its IUPAC name is 1-[1-[2-aminoprop-2-enyl(2-cyclopentylethyl)amino]ethenyl]-N-(4-methylphenyl)pyrrolidine-2-carboxamide;heptane.
| Compound Name | 1-[1-[2-aminoprop-2-enyl(2-cyclopentylethyl)amino]ethenyl]-N-(4-methylphenyl)pyrrolidine-2-carboxamide;heptane |
|---|---|
| PubChem CID | 142070720 |
| Molecular Formula | C31H52N4O |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.41 |
| IUPAC Name | 1-[1-[2-aminoprop-2-enyl(2-cyclopentylethyl)amino]ethenyl]-N-(4-methylphenyl)pyrrolidine-2-carboxamide;heptane |
| SMILES | C=C(N)CN(CCC1CCCC1)C(=C)N1CCCC1C(=O)Nc1ccc(C)cc1.CCCCCCC |
| InChI | InChI=1S/C24H36N4O.C7H16/c1-18-10-12-22(13-11-18)26-24(29)23-9-6-15-28(23)20(3)27(17-19(2)25)16-14-21-7-4-5-8-21;1-3-5-7-6-4-2/h10-13,21,23H,2-9,14-17,25H2,1H3,(H,26,29);3-7H2,1-2H3 |
| InChIKey | ZGHKYZUPJHXSFC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|