C26H32FN3OS2 — CID 142071674
4-[(E)-2-(1-amino-4-sulfanylpyrrolidin-2-yl)ethenyl]-2-(4-fluorophenyl)-N-[(E)-4-methyl-1-methylsulfanylpent-2-en-3-yl]benzamide (PubChem CID 142071674) has the molecular formula C26H32FN3OS2 and a molecular weight of 485.69 g/mol. Its IUPAC name is 4-[(E)-2-(1-amino-4-sulfanylpyrrolidin-2-yl)ethenyl]-2-(4-fluorophenyl)-N-[(E)-4-methyl-1-methylsulfanylpent-2-en-3-yl]benzamide.
| Compound Name | 4-[(E)-2-(1-amino-4-sulfanylpyrrolidin-2-yl)ethenyl]-2-(4-fluorophenyl)-N-[(E)-4-methyl-1-methylsulfanylpent-2-en-3-yl]benzamide |
|---|---|
| PubChem CID | 142071674 |
| Molecular Formula | C26H32FN3OS2 |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[(E)-2-(1-amino-4-sulfanylpyrrolidin-2-yl)ethenyl]-2-(4-fluorophenyl)-N-[(E)-4-methyl-1-methylsulfanylpent-2-en-3-yl]benzamide |
| SMILES | CSC/C=C(/NC(=O)c1ccc(/C=C/C2CC(S)CN2N)cc1-c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C26H32FN3OS2/c1-17(2)25(12-13-33-3)29-26(31)23-11-5-18(4-10-21-15-22(32)16-30(21)28)14-24(23)19-6-8-20(27)9-7-19/h4-12,14,17,21-22,32H,13,15-16,28H2,1-3H3,(H,29,31)/b10-4+,25-12+ |
| InChIKey | OMPYYXWPGMBFSW-PANDUBDISA-N |
| XLogP | 5.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|