About ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene
ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene (PubChem CID 142072053) has the molecular formula C15H26S
and a molecular weight of 238.44 g/mol. Its IUPAC name is ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene.
Molecular Properties
| Compound Name | ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene |
| PubChem CID | 142072053 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene |
| SMILES | CC.CC.CCC1Cc2cc(C)ccc2S1 |
| InChI | InChI=1S/C11H14S.2C2H6/c1-3-10-7-9-6-8(2)4-5-11(9)12-10;2*1-2/h4-6,10H,3,7H2,1-2H3;2*1-2H3 |
| InChIKey | NYMRQRPNLIEYES-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene?
The IUPAC name of ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene (CID 142072053) is ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene.
What is the SMILES notation for ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene?
The canonical SMILES for ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene is CC.CC.CCC1Cc2cc(C)ccc2S1.
What is the InChIKey of ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene?
The InChIKey is NYMRQRPNLIEYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14S.2C2H6/c1-3-10-7-9-6-8(2)4-5-11(9)12-10;2*1-2/h4-6,10H,3,7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene?
ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene has a molecular weight of 238.44 g/mol, XLogP of 5.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-5-methyl-2,3-dihydro-1-benzothiophene is sourced from PubChem (CID 142072053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).