About N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide
N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide (PubChem CID 142073649) has the molecular formula C8H17N5O
and a molecular weight of 199.26 g/mol. Its IUPAC name is N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide |
| PubChem CID | 142073649 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\N)N/C(=N\C)N1CCOCC1 |
| InChI | InChI=1S/C8H17N5O/c1-10-7(9)12-8(11-2)13-3-5-14-6-4-13/h3-6H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | DTYHPWPPCIUKFR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide?
The IUPAC name of N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide (CID 142073649) is N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide.
What is the SMILES notation for N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide?
The canonical SMILES for N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide is C/N=C(\N)N/C(=N\C)N1CCOCC1.
What is the InChIKey of N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide?
The InChIKey is DTYHPWPPCIUKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N5O/c1-10-7(9)12-8(11-2)13-3-5-14-6-4-13/h3-6H2,1-2H3,(H3,9,10,11,12).
What are the key properties of N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide?
N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide has a molecular weight of 199.26 g/mol, XLogP of -1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-(N'-methylcarbamimidoyl)morpholine-4-carboximidamide is sourced from PubChem (CID 142073649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).